C16H19IN2O2 — CID 62874629
5-tert-butyl-1-(3,5-dimethylphenyl)-4-iodopyrazole-3-carboxylic acid (PubChem CID 62874629) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is 5-tert-butyl-1-(3,5-dimethylphenyl)-4-iodopyrazole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-1-(3,5-dimethylphenyl)-4-iodopyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 62874629 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 5-tert-butyl-1-(3,5-dimethylphenyl)-4-iodopyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C)cc(-n2nc(C(=O)O)c(I)c2C(C)(C)C)c1 |
| InChI | InChI=1S/C16H19IN2O2/c1-9-6-10(2)8-11(7-9)19-14(16(3,4)5)12(17)13(18-19)15(20)21/h6-8H,1-5H3,(H,20,21) |
| InChIKey | BCSYJGXHMUGYGW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|