C31H38N2O7 — CID 6287513
(4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-(3-methoxy-4-prop-2-enoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6287513) has the molecular formula C31H38N2O7 and a molecular weight of 550.65 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-(3-methoxy-4-prop-2-enoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-(3-methoxy-4-prop-2-enoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6287513 |
| Molecular Formula | C31H38N2O7 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-(3-methoxy-4-prop-2-enoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2/C(=C(\O)c3ccc(OC(C)C)cc3)C(=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C31H38N2O7/c1-5-17-39-25-12-9-23(20-26(25)37-4)28-27(29(34)22-7-10-24(11-8-22)40-21(2)3)30(35)31(36)33(28)14-6-13-32-15-18-38-19-16-32/h5,7-12,20-21,28,34H,1,6,13-19H2,2-4H3/b29-27+ |
| InChIKey | MRAQJSJYPXJLEP-ORIPQNMZSA-N |
| XLogP | 4.19 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|