C11H16N4O4S — CID 62876001
4-(2-methoxypyridine-3-carbonyl)piperazine-1-sulfonamide (PubChem CID 62876001) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-(2-methoxypyridine-3-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(2-methoxypyridine-3-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 62876001 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-(2-methoxypyridine-3-carbonyl)piperazine-1-sulfonamide |
| SMILES | COc1ncccc1C(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C11H16N4O4S/c1-19-10-9(3-2-4-13-10)11(16)14-5-7-15(8-6-14)20(12,17)18/h2-4H,5-8H2,1H3,(H2,12,17,18) |
| InChIKey | HKOMQDYZBXYVPF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |