C14H14N6 — CID 62876095
6-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)quinoxaline (PubChem CID 62876095) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 6-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)quinoxaline.
| Compound Name | 6-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)quinoxaline |
|---|---|
| PubChem CID | 62876095 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)quinoxaline |
| SMILES | CC1NCCn2c(-c3ccc4nccnc4c3)nnc21 |
| InChI | InChI=1S/C14H14N6/c1-9-13-18-19-14(20(13)7-6-15-9)10-2-3-11-12(8-10)17-5-4-16-11/h2-5,8-9,15H,6-7H2,1H3 |
| InChIKey | BTCVWAIOISGFHZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |