C17H26N2OS — CID 62876706
3-amino-N,N-dibutyl-2-phenyl-3-sulfanylidenepropanamide (PubChem CID 62876706) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-amino-N,N-dibutyl-2-phenyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N,N-dibutyl-2-phenyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 62876706 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-amino-N,N-dibutyl-2-phenyl-3-sulfanylidenepropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(C(N)=S)c1ccccc1 |
| InChI | InChI=1S/C17H26N2OS/c1-3-5-12-19(13-6-4-2)17(20)15(16(18)21)14-10-8-7-9-11-14/h7-11,15H,3-6,12-13H2,1-2H3,(H2,18,21) |
| InChIKey | ZHTKASUXMAKRKR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|