C14H22N2O — CID 62878034
N'-(oxolan-3-ylmethyl)-2-phenylpropane-1,3-diamine (PubChem CID 62878034) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N'-(oxolan-3-ylmethyl)-2-phenylpropane-1,3-diamine.
| Compound Name | N'-(oxolan-3-ylmethyl)-2-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62878034 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N'-(oxolan-3-ylmethyl)-2-phenylpropane-1,3-diamine |
| SMILES | NCC(CNCC1CCOC1)c1ccccc1 |
| InChI | InChI=1S/C14H22N2O/c15-8-14(13-4-2-1-3-5-13)10-16-9-12-6-7-17-11-12/h1-5,12,14,16H,6-11,15H2 |
| InChIKey | IURDVOQZHJPOTH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |