C23H30O5 — CID 628784
(5,20-dimethyl-15,18-dioxo-19-oxapentacyclo[11.4.3.01,13.02,10.05,9]icos-11-en-6-yl) acetate (PubChem CID 628784) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (5,20-dimethyl-15,18-dioxo-19-oxapentacyclo[11.4.3.01,13.02,10.05,9]icos-11-en-6-yl) acetate.
| Compound Name | (5,20-dimethyl-15,18-dioxo-19-oxapentacyclo[11.4.3.01,13.02,10.05,9]icos-11-en-6-yl) acetate |
|---|---|
| PubChem CID | 628784 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (5,20-dimethyl-15,18-dioxo-19-oxapentacyclo[11.4.3.01,13.02,10.05,9]icos-11-en-6-yl) acetate |
| SMILES | CC(=O)OC1CCC2C3C=CC45CC(=O)CCC4(C(=O)OC5C)C3CCC12C |
| InChI | InChI=1S/C23H30O5/c1-13-22-10-7-16-17-4-5-19(28-14(2)24)21(17,3)9-8-18(16)23(22,20(26)27-13)11-6-15(25)12-22/h7,10,13,16-19H,4-6,8-9,11-12H2,1-3H3 |
| InChIKey | NBAQPMWAMXHTCG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|