C15H26N2 — CID 62880739
2-N-ethyl-4-phenyl-2-N-propylbutane-1,2-diamine (PubChem CID 62880739) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-N-ethyl-4-phenyl-2-N-propylbutane-1,2-diamine.
| Compound Name | 2-N-ethyl-4-phenyl-2-N-propylbutane-1,2-diamine |
|---|---|
| PubChem CID | 62880739 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-N-ethyl-4-phenyl-2-N-propylbutane-1,2-diamine |
| SMILES | CCCN(CC)C(CN)CCc1ccccc1 |
| InChI | InChI=1S/C15H26N2/c1-3-12-17(4-2)15(13-16)11-10-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13,16H2,1-2H3 |
| InChIKey | GAPCHNVJFCHXBN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |