C12H22N4O3S — CID 62882054
2-amino-2-methyl-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid (PubChem CID 62882054) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-amino-2-methyl-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid.
| Compound Name | 2-amino-2-methyl-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 62882054 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-amino-2-methyl-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
| SMILES | CCCn1c(SCCCCC(C)(N)C(=O)O)n[nH]c1=O |
| InChI | InChI=1S/C12H22N4O3S/c1-3-7-16-10(19)14-15-11(16)20-8-5-4-6-12(2,13)9(17)18/h3-8,13H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | WZGFHEIKBZDZJN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|