C13H24N4O3S — CID 62882057
2-(ethylamino)-2-methyl-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid (PubChem CID 62882057) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid.
| Compound Name | 2-(ethylamino)-2-methyl-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 62882057 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-(ethylamino)-2-methyl-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid |
| SMILES | CCCn1c(SCCCC(C)(NCC)C(=O)O)n[nH]c1=O |
| InChI | InChI=1S/C13H24N4O3S/c1-4-8-17-11(20)15-16-12(17)21-9-6-7-13(3,10(18)19)14-5-2/h14H,4-9H2,1-3H3,(H,15,20)(H,18,19) |
| InChIKey | BHWMBFFXCXYWCK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|