C12H15N5O2S — CID 62882376
5-amino-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide (PubChem CID 62882376) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 5-amino-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide.
| Compound Name | 5-amino-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 62882376 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 5-amino-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzamide |
| SMILES | CCCn1c(Sc2ccc(N)cc2C(N)=O)n[nH]c1=O |
| InChI | InChI=1S/C12H15N5O2S/c1-2-5-17-11(19)15-16-12(17)20-9-4-3-7(13)6-8(9)10(14)18/h3-4,6H,2,5,13H2,1H3,(H2,14,18)(H,15,19) |
| InChIKey | MEGGKBRWUZXYNT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 119.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|