C12H20N4O3S — CID 62882637
2-(cyclopropylamino)-2-methyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid (PubChem CID 62882637) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid.
| Compound Name | 2-(cyclopropylamino)-2-methyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 62882637 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pentanoic acid |
| SMILES | Cn1c(SCCCC(C)(NC2CC2)C(=O)O)n[nH]c1=O |
| InChI | InChI=1S/C12H20N4O3S/c1-12(9(17)18,13-8-4-5-8)6-3-7-20-11-15-14-10(19)16(11)2/h8,13H,3-7H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | APHRLBINUQYOQH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|