C12H13F3N4OS — CID 62882661
3-[4-amino-3-(trifluoromethyl)phenyl]sulfanyl-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 62882661) has the molecular formula C12H13F3N4OS and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-[4-amino-3-(trifluoromethyl)phenyl]sulfanyl-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[4-amino-3-(trifluoromethyl)phenyl]sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62882661 |
| Molecular Formula | C12H13F3N4OS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-[4-amino-3-(trifluoromethyl)phenyl]sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(Sc2ccc(N)c(C(F)(F)F)c2)n[nH]c1=O |
| InChI | InChI=1S/C12H13F3N4OS/c1-2-5-19-10(20)17-18-11(19)21-7-3-4-9(16)8(6-7)12(13,14)15/h3-4,6H,2,5,16H2,1H3,(H,17,20) |
| InChIKey | RDXFVWRNWFRLKP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|