C16H14N2O2 — CID 62882792
3,5-diphenyl-1,3-diazinane-2,4-dione (PubChem CID 62882792) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3,5-diphenyl-1,3-diazinane-2,4-dione.
| Compound Name | 3,5-diphenyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 62882792 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3,5-diphenyl-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2/c19-15-14(12-7-3-1-4-8-12)11-17-16(20)18(15)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,17,20) |
| InChIKey | UJSKGXYHGRUYSL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |