C8H15N5OS — CID 62882879
3-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropanimidamide (PubChem CID 62882879) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is 3-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropanimidamide.
| Compound Name | 3-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 62882879 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CSc1n[nH]c(=O)n1CC |
| InChI | InChI=1S/C8H15N5OS/c1-3-13-7(14)11-12-8(13)15-4-5(2)6(9)10/h5H,3-4H2,1-2H3,(H3,9,10)(H,11,14) |
| InChIKey | JHULBJJIPLEXJN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|