About 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one
4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 62883136) has the molecular formula C8H11N7OS2
and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one |
| PubChem CID | 62883136 |
| Molecular Formula | C8H11N7OS2 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | NNc1snnc1CSc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C8H11N7OS2/c9-10-6-5(11-14-18-6)3-17-8-13-12-7(16)15(8)4-1-2-4/h4,10H,1-3,9H2,(H,12,16) |
| InChIKey | GYIPPBYVCRROGX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one (CID 62883136) is 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one is NNc1snnc1CSc1n[nH]c(=O)n1C1CC1.
What is the InChIKey of 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one?
The InChIKey is GYIPPBYVCRROGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N7OS2/c9-10-6-5(11-14-18-6)3-17-8-13-12-7(16)15(8)4-1-2-4/h4,10H,1-3,9H2,(H,12,16).
What are the key properties of 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one?
4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one has a molecular weight of 285.36 g/mol, XLogP of 0.34, 5 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-3-[(5-hydrazinylthiadiazol-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 62883136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).