About 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one
3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 62883197) has the molecular formula C11H13BrN4OS
and a molecular weight of 329.22 g/mol. Its IUPAC name is 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| PubChem CID | 62883197 |
| Molecular Formula | C11H13BrN4OS |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1c(Sc2ccc(Br)cc2N)n[nH]c1=O |
| InChI | InChI=1S/C11H13BrN4OS/c1-6(2)16-10(17)14-15-11(16)18-9-4-3-7(12)5-8(9)13/h3-6H,13H2,1-2H3,(H,14,17) |
| InChIKey | XZMPNCZXHNRBOC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one (CID 62883197) is 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one is CC(C)n1c(Sc2ccc(Br)cc2N)n[nH]c1=O.
What is the InChIKey of 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The InChIKey is XZMPNCZXHNRBOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN4OS/c1-6(2)16-10(17)14-15-11(16)18-9-4-3-7(12)5-8(9)13/h3-6H,13H2,1-2H3,(H,14,17).
What are the key properties of 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one?
3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one has a molecular weight of 329.22 g/mol, XLogP of 2.65, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-bromophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 62883197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).