C13H22N4O3S — CID 62883295
6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid (PubChem CID 62883295) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid.
| Compound Name | 6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 62883295 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid |
| SMILES | CNC(C)(CCCCSc1n[nH]c(=O)n1C1CC1)C(=O)O |
| InChI | InChI=1S/C13H22N4O3S/c1-13(14-2,10(18)19)7-3-4-8-21-12-16-15-11(20)17(12)9-5-6-9/h9,14H,3-8H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | JKNMPRDZQGQIJJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|