About 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one
3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one (PubChem CID 62883368) has the molecular formula C11H11N5O3S
and a molecular weight of 293.31 g/mol. Its IUPAC name is 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one |
| PubChem CID | 62883368 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one |
| SMILES | Nc1cc([N+](=O)[O-])ccc1Sc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C11H11N5O3S/c12-8-5-7(16(18)19)3-4-9(8)20-11-14-13-10(17)15(11)6-1-2-6/h3-6H,1-2,12H2,(H,13,17) |
| InChIKey | AGQKVPYZTDAPRU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one (CID 62883368) is 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one is Nc1cc([N+](=O)[O-])ccc1Sc1n[nH]c(=O)n1C1CC1.
What is the InChIKey of 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one?
The InChIKey is AGQKVPYZTDAPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O3S/c12-8-5-7(16(18)19)3-4-9(8)20-11-14-13-10(17)15(11)6-1-2-6/h3-6H,1-2,12H2,(H,13,17).
What are the key properties of 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one?
3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one has a molecular weight of 293.31 g/mol, XLogP of 1.55, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-nitrophenyl)sulfanyl-4-cyclopropyl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 62883368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).