About 5-phenyl-3-propyl-1,3-diazinane-2,4-dione
5-phenyl-3-propyl-1,3-diazinane-2,4-dione (PubChem CID 62884724) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-phenyl-3-propyl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-phenyl-3-propyl-1,3-diazinane-2,4-dione |
| PubChem CID | 62884724 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-phenyl-3-propyl-1,3-diazinane-2,4-dione |
| SMILES | CCCN1C(=O)NCC(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H16N2O2/c1-2-8-15-12(16)11(9-14-13(15)17)10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,14,17) |
| InChIKey | GJJOUWDDJQLFPP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-3-propyl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-3-propyl-1,3-diazinane-2,4-dione?
The IUPAC name of 5-phenyl-3-propyl-1,3-diazinane-2,4-dione (CID 62884724) is 5-phenyl-3-propyl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-phenyl-3-propyl-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-phenyl-3-propyl-1,3-diazinane-2,4-dione is CCCN1C(=O)NCC(c2ccccc2)C1=O.
What is the InChIKey of 5-phenyl-3-propyl-1,3-diazinane-2,4-dione?
The InChIKey is GJJOUWDDJQLFPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-2-8-15-12(16)11(9-14-13(15)17)10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,14,17).
What are the key properties of 5-phenyl-3-propyl-1,3-diazinane-2,4-dione?
5-phenyl-3-propyl-1,3-diazinane-2,4-dione has a molecular weight of 232.28 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-3-propyl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 62884724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).