C8H6Cl2N4S — CID 62885118
3,6-dichloro-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine (PubChem CID 62885118) has the molecular formula C8H6Cl2N4S and a molecular weight of 261.14 g/mol. Its IUPAC name is 3,6-dichloro-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine.
| Compound Name | 3,6-dichloro-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine |
|---|---|
| PubChem CID | 62885118 |
| Molecular Formula | C8H6Cl2N4S |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 3,6-dichloro-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine |
| SMILES | Clc1ccc(Cl)c(CSc2ncn[nH]2)n1 |
| InChI | InChI=1S/C8H6Cl2N4S/c9-5-1-2-7(10)13-6(5)3-15-8-11-4-12-14-8/h1-2,4H,3H2,(H,11,12,14) |
| InChIKey | IVTUHXJXTOLGRC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|