C14H15ClN2O3S — CID 62885480
5-chloro-N-methyl-6-[(3-methylsulfonylphenoxy)methyl]pyridin-2-amine (PubChem CID 62885480) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 5-chloro-N-methyl-6-[(3-methylsulfonylphenoxy)methyl]pyridin-2-amine.
| Compound Name | 5-chloro-N-methyl-6-[(3-methylsulfonylphenoxy)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62885480 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 5-chloro-N-methyl-6-[(3-methylsulfonylphenoxy)methyl]pyridin-2-amine |
| SMILES | CNc1ccc(Cl)c(COc2cccc(S(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-16-14-7-6-12(15)13(17-14)9-20-10-4-3-5-11(8-10)21(2,18)19/h3-8H,9H2,1-2H3,(H,16,17) |
| InChIKey | BCMKFODFXAERSQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |