C27H32BrN3O2 — CID 6288575
[(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate (PubChem CID 6288575) has the molecular formula C27H32BrN3O2 and a molecular weight of 510.48 g/mol. Its IUPAC name is [(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate.
| Compound Name | [(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 6288575 |
| Molecular Formula | C27H32BrN3O2 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | [(E)-[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
| SMILES | CC12CCC(C/C1=N\OC(=O)C13CCC(C)(c4nc5ccccc5nc41)C3(C)C)C2(C)CBr |
| InChI | InChI=1S/C27H32BrN3O2/c1-23(2)25(4)12-13-27(23,21-20(25)29-17-8-6-7-9-18(17)30-21)22(32)33-31-19-14-16-10-11-24(19,3)26(16,5)15-28/h6-9,16H,10-15H2,1-5H3/b31-19+ |
| InChIKey | BTSWPNDUQCNJHX-ZCTHSVRISA-N |
| XLogP | 6.08 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|