About 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine
5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine (PubChem CID 62885792) has the molecular formula C11H14ClF3N2O
and a molecular weight of 282.69 g/mol. Its IUPAC name is 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine |
| PubChem CID | 62885792 |
| Molecular Formula | C11H14ClF3N2O |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine |
| SMILES | CCCNc1ccc(Cl)c(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H14ClF3N2O/c1-2-5-16-10-4-3-8(12)9(17-10)6-18-7-11(13,14)15/h3-4H,2,5-7H2,1H3,(H,16,17) |
| InChIKey | TWQPEEOYBAAWSE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine?
The IUPAC name of 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine (CID 62885792) is 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine.
What is the SMILES notation for 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine?
The canonical SMILES for 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine is CCCNc1ccc(Cl)c(COCC(F)(F)F)n1.
What is the InChIKey of 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine?
The InChIKey is TWQPEEOYBAAWSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClF3N2O/c1-2-5-16-10-4-3-8(12)9(17-10)6-18-7-11(13,14)15/h3-4H,2,5-7H2,1H3,(H,16,17).
What are the key properties of 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine?
5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine has a molecular weight of 282.69 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-propyl-6-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine is sourced from PubChem (CID 62885792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).