C9H11Cl2NS — CID 62885812
3,6-dichloro-2-(propan-2-ylsulfanylmethyl)pyridine (PubChem CID 62885812) has the molecular formula C9H11Cl2NS and a molecular weight of 236.17 g/mol. Its IUPAC name is 3,6-dichloro-2-(propan-2-ylsulfanylmethyl)pyridine.
| Compound Name | 3,6-dichloro-2-(propan-2-ylsulfanylmethyl)pyridine |
|---|---|
| PubChem CID | 62885812 |
| Molecular Formula | C9H11Cl2NS |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 3,6-dichloro-2-(propan-2-ylsulfanylmethyl)pyridine |
| SMILES | CC(C)SCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H11Cl2NS/c1-6(2)13-5-8-7(10)3-4-9(11)12-8/h3-4,6H,5H2,1-2H3 |
| InChIKey | KTAHEAWYIZHQGG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|