C11H23N3O — CID 62887185
N,N-dimethyl-2-[4-(oxiran-2-ylmethyl)piperazin-1-yl]ethanamine (PubChem CID 62887185) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(oxiran-2-ylmethyl)piperazin-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-(oxiran-2-ylmethyl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 62887185 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N,N-dimethyl-2-[4-(oxiran-2-ylmethyl)piperazin-1-yl]ethanamine |
| SMILES | CN(C)CCN1CCN(CC2CO2)CC1 |
| InChI | InChI=1S/C11H23N3O/c1-12(2)3-4-13-5-7-14(8-6-13)9-11-10-15-11/h11H,3-10H2,1-2H3 |
| InChIKey | PERUUEYGBYPPOI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 22.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|