About [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine
[5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine (PubChem CID 62887369) has the molecular formula C8H9ClF3N3O
and a molecular weight of 255.63 g/mol. Its IUPAC name is [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine |
| PubChem CID | 62887369 |
| Molecular Formula | C8H9ClF3N3O |
| Molecular Weight | 255.63 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H9ClF3N3O/c9-5-1-2-7(15-13)14-6(5)3-16-4-8(10,11)12/h1-2H,3-4,13H2,(H,14,15) |
| InChIKey | LXUVHCYZCKBGCN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine?
The IUPAC name of [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine (CID 62887369) is [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine?
The canonical SMILES for [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine is NNc1ccc(Cl)c(COCC(F)(F)F)n1.
What is the InChIKey of [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine?
The InChIKey is LXUVHCYZCKBGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3N3O/c9-5-1-2-7(15-13)14-6(5)3-16-4-8(10,11)12/h1-2H,3-4,13H2,(H,14,15).
What are the key properties of [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine?
[5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine has a molecular weight of 255.63 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-6-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 62887369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).