About 2-(but-3-enoxymethyl)-3,6-dichloropyridine
2-(but-3-enoxymethyl)-3,6-dichloropyridine (PubChem CID 62887557) has the molecular formula C10H11Cl2NO
and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-(but-3-enoxymethyl)-3,6-dichloropyridine.
Molecular Properties
| Compound Name | 2-(but-3-enoxymethyl)-3,6-dichloropyridine |
| PubChem CID | 62887557 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-(but-3-enoxymethyl)-3,6-dichloropyridine |
| SMILES | C=CCCOCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H11Cl2NO/c1-2-3-6-14-7-9-8(11)4-5-10(12)13-9/h2,4-5H,1,3,6-7H2 |
| InChIKey | INTJOZAUGAXDBZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(but-3-enoxymethyl)-3,6-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(but-3-enoxymethyl)-3,6-dichloropyridine?
The IUPAC name of 2-(but-3-enoxymethyl)-3,6-dichloropyridine (CID 62887557) is 2-(but-3-enoxymethyl)-3,6-dichloropyridine.
What is the SMILES notation for 2-(but-3-enoxymethyl)-3,6-dichloropyridine?
The canonical SMILES for 2-(but-3-enoxymethyl)-3,6-dichloropyridine is C=CCCOCc1nc(Cl)ccc1Cl.
What is the InChIKey of 2-(but-3-enoxymethyl)-3,6-dichloropyridine?
The InChIKey is INTJOZAUGAXDBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO/c1-2-3-6-14-7-9-8(11)4-5-10(12)13-9/h2,4-5H,1,3,6-7H2.
What are the key properties of 2-(but-3-enoxymethyl)-3,6-dichloropyridine?
2-(but-3-enoxymethyl)-3,6-dichloropyridine has a molecular weight of 232.11 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(but-3-enoxymethyl)-3,6-dichloropyridine is sourced from PubChem (CID 62887557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).