C26H21N3O3S — CID 6288758
(2Z)-2-(5-benzyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)-2-cyano-N-(4-methoxyphenyl)acetamide (PubChem CID 6288758) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is (2Z)-2-(5-benzyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)-2-cyano-N-(4-methoxyphenyl)acetamide.
| Compound Name | (2Z)-2-(5-benzyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)-2-cyano-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 6288758 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (2Z)-2-(5-benzyl-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)-2-cyano-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C2\SC(Cc3ccccc3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O3S/c1-32-21-14-12-19(13-15-21)28-24(30)22(17-27)26-29(20-10-6-3-7-11-20)25(31)23(33-26)16-18-8-4-2-5-9-18/h2-15,23H,16H2,1H3,(H,28,30)/b26-22- |
| InChIKey | YTRPFSYWQBYOIH-ROMGYVFFSA-N |
| XLogP | 4.76 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|