C19H18O3 — CID 6288850
(E)-3-(4-methoxyphenyl)-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one (PubChem CID 6288850) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6288850 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)CC(C)O3)cc1 |
| InChI | InChI=1S/C19H18O3/c1-13-11-16-12-15(6-10-19(16)22-13)18(20)9-5-14-3-7-17(21-2)8-4-14/h3-10,12-13H,11H2,1-2H3/b9-5+ |
| InChIKey | JMZNMHYCTFGHBJ-WEVVVXLNSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|