C17H19N3O — CID 62888578
3-[[2-(propylaminomethyl)phenoxy]methyl]pyridine-2-carbonitrile (PubChem CID 62888578) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[[2-(propylaminomethyl)phenoxy]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[2-(propylaminomethyl)phenoxy]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62888578 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-[[2-(propylaminomethyl)phenoxy]methyl]pyridine-2-carbonitrile |
| SMILES | CCCNCc1ccccc1OCc1cccnc1C#N |
| InChI | InChI=1S/C17H19N3O/c1-2-9-19-12-14-6-3-4-8-17(14)21-13-15-7-5-10-20-16(15)11-18/h3-8,10,19H,2,9,12-13H2,1H3 |
| InChIKey | PUHQZVGJVREQDA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|