About 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine
2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 62889323) has the molecular formula C14H28N6
and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 62889323 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | Cc1nn(C)c(N2CCN(CCN(C)C)CC2)c1CN |
| InChI | InChI=1S/C14H28N6/c1-12-13(11-15)14(18(4)16-12)20-9-7-19(8-10-20)6-5-17(2)3/h5-11,15H2,1-4H3 |
| InChIKey | CAWFNRXRXCWYBA-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 53.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine (CID 62889323) is 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine is Cc1nn(C)c(N2CCN(CCN(C)C)CC2)c1CN.
What is the InChIKey of 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine?
The InChIKey is CAWFNRXRXCWYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N6/c1-12-13(11-15)14(18(4)16-12)20-9-7-19(8-10-20)6-5-17(2)3/h5-11,15H2,1-4H3.
What are the key properties of 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine?
2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine has a molecular weight of 280.42 g/mol, XLogP of -0.13, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperazin-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 62889323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).