C10H21ClN2O2S — CID 62889427
1-[1-(3-chloropropylsulfonyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 62889427) has the molecular formula C10H21ClN2O2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 1-[1-(3-chloropropylsulfonyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-(3-chloropropylsulfonyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 62889427 |
| Molecular Formula | C10H21ClN2O2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[1-(3-chloropropylsulfonyl)pyrrolidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCCN1S(=O)(=O)CCCCl |
| InChI | InChI=1S/C10H21ClN2O2S/c1-12(2)9-10-5-3-7-13(10)16(14,15)8-4-6-11/h10H,3-9H2,1-2H3 |
| InChIKey | UUPLQNWGGYBHMK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|