C15H33N5O — CID 62890058
5-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methyl-2-(methylamino)pentanamide (PubChem CID 62890058) has the molecular formula C15H33N5O and a molecular weight of 299.46 g/mol. Its IUPAC name is 5-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methyl-2-(methylamino)pentanamide.
| Compound Name | 5-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 62890058 |
| Molecular Formula | C15H33N5O |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.27 |
| IUPAC Name | 5-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methyl-2-(methylamino)pentanamide |
| SMILES | CNC(C)(CCCN1CCN(CCN(C)C)CC1)C(N)=O |
| InChI | InChI=1S/C15H33N5O/c1-15(17-2,14(16)21)6-5-7-19-10-12-20(13-11-19)9-8-18(3)4/h17H,5-13H2,1-4H3,(H2,16,21) |
| InChIKey | XQIBWPOKRMROOP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |