C15H22BrN3O2 — CID 62890375
(4-bromo-2-hydroxyphenyl)-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methanone (PubChem CID 62890375) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is (4-bromo-2-hydroxyphenyl)-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methanone.
| Compound Name | (4-bromo-2-hydroxyphenyl)-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 62890375 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (4-bromo-2-hydroxyphenyl)-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methanone |
| SMILES | CN(C)CCN1CCN(C(=O)c2ccc(Br)cc2O)CC1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-17(2)5-6-18-7-9-19(10-8-18)15(21)13-4-3-12(16)11-14(13)20/h3-4,11,20H,5-10H2,1-2H3 |
| InChIKey | UQELXFUUDZKMTL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |