C10H14ClF3N4 — CID 62890424
N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-ethyl-2,2,2-trifluoroethanamine (PubChem CID 62890424) has the molecular formula C10H14ClF3N4 and a molecular weight of 282.70 g/mol. Its IUPAC name is N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-ethyl-2,2,2-trifluoroethanamine.
| Compound Name | N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-ethyl-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 62890424 |
| Molecular Formula | C10H14ClF3N4 |
| Molecular Weight | 282.70 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-ethyl-2,2,2-trifluoroethanamine |
| SMILES | CCN(Cc1nc(NN)ccc1Cl)CC(F)(F)F |
| InChI | InChI=1S/C10H14ClF3N4/c1-2-18(6-10(12,13)14)5-8-7(11)3-4-9(16-8)17-15/h3-4H,2,5-6,15H2,1H3,(H,16,17) |
| InChIKey | DRJIDCVEPWQZRE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|