About methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate
methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate (PubChem CID 628912) has the molecular formula C11H12N2O9
and a molecular weight of 316.22 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate.
Molecular Properties
| Compound Name | methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate |
| PubChem CID | 628912 |
| Molecular Formula | C11H12N2O9 |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate |
| SMILES | COC(=O)c1c([N+](=O)[O-])c(OC)c(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O9/c1-19-8-6(12(15)16)5(11(14)22-4)7(13(17)18)9(20-2)10(8)21-3/h1-4H3 |
| InChIKey | AAMUAUAHCKODNJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate?
The IUPAC name of methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate (CID 628912) is methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate.
What is the SMILES notation for methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate?
The canonical SMILES for methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate is COC(=O)c1c([N+](=O)[O-])c(OC)c(OC)c(OC)c1[N+](=O)[O-].
What is the InChIKey of methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate?
The InChIKey is AAMUAUAHCKODNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O9/c1-19-8-6(12(15)16)5(11(14)22-4)7(13(17)18)9(20-2)10(8)21-3/h1-4H3.
What are the key properties of methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate?
methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate has a molecular weight of 316.22 g/mol, XLogP of 1.32, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4,5-trimethoxy-2,6-dinitrobenzoate is sourced from PubChem (CID 628912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).