C16H23Cl2N3 — CID 62891457
N-[(3,6-dichloro-2-pyridinyl)methyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 62891457) has the molecular formula C16H23Cl2N3 and a molecular weight of 328.29 g/mol. Its IUPAC name is N-[(3,6-dichloro-2-pyridinyl)methyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 62891457 |
| Molecular Formula | C16H23Cl2N3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CCCN(Cc1nc(Cl)ccc1Cl)C1CC2CCC(C1)N2 |
| InChI | InChI=1S/C16H23Cl2N3/c1-2-7-21(10-15-14(17)5-6-16(18)20-15)13-8-11-3-4-12(9-13)19-11/h5-6,11-13,19H,2-4,7-10H2,1H3 |
| InChIKey | YURDKMGHMGMQIJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|