C11H16ClF3N4 — CID 62891659
N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 62891659) has the molecular formula C11H16ClF3N4 and a molecular weight of 296.72 g/mol. Its IUPAC name is N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 62891659 |
| Molecular Formula | C11H16ClF3N4 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CCCN(Cc1nc(NN)ccc1Cl)CC(F)(F)F |
| InChI | InChI=1S/C11H16ClF3N4/c1-2-5-19(7-11(13,14)15)6-9-8(12)3-4-10(17-9)18-16/h3-4H,2,5-7,16H2,1H3,(H,17,18) |
| InChIKey | FOLVPYOHFMWEPQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|