About 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline
4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline (PubChem CID 62892117) has the molecular formula C10H4ClF4N
and a molecular weight of 249.59 g/mol. Its IUPAC name is 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline.
Molecular Properties
| Compound Name | 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline |
| PubChem CID | 62892117 |
| Molecular Formula | C10H4ClF4N |
| Molecular Weight | 249.59 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline |
| SMILES | Fc1cc(F)c2c(Cl)cc(C(F)F)nc2c1 |
| InChI | InChI=1S/C10H4ClF4N/c11-5-3-8(10(14)15)16-7-2-4(12)1-6(13)9(5)7/h1-3,10H |
| InChIKey | CBDADWPYBYLOJO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline?
The IUPAC name of 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline (CID 62892117) is 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline.
What is the SMILES notation for 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline?
The canonical SMILES for 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline is Fc1cc(F)c2c(Cl)cc(C(F)F)nc2c1.
What is the InChIKey of 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline?
The InChIKey is CBDADWPYBYLOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4ClF4N/c11-5-3-8(10(14)15)16-7-2-4(12)1-6(13)9(5)7/h1-3,10H.
What are the key properties of 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline?
4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline has a molecular weight of 249.59 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(difluoromethyl)-5,7-difluoroquinoline is sourced from PubChem (CID 62892117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).