About N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine
N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine (PubChem CID 62892495) has the molecular formula C12H18Cl2N2
and a molecular weight of 261.20 g/mol. Its IUPAC name is N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine |
| PubChem CID | 62892495 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine |
| SMILES | CC(C)C(C)N(C)Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-8(2)9(3)16(4)7-11-10(13)5-6-12(14)15-11/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | XJBWTRDZCLCLSB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine?
The IUPAC name of N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine (CID 62892495) is N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine.
What is the SMILES notation for N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine?
The canonical SMILES for N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine is CC(C)C(C)N(C)Cc1nc(Cl)ccc1Cl.
What is the InChIKey of N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine?
The InChIKey is XJBWTRDZCLCLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Cl2N2/c1-8(2)9(3)16(4)7-11-10(13)5-6-12(14)15-11/h5-6,8-9H,7H2,1-4H3.
What are the key properties of N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine?
N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine has a molecular weight of 261.20 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 62892495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).