C12H18Cl2N2 — CID 62892495
N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine (PubChem CID 62892495) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine.
| Compound Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 62892495 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N,3-dimethylbutan-2-amine |
| SMILES | CC(C)C(C)N(C)Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-8(2)9(3)16(4)7-11-10(13)5-6-12(14)15-11/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | XJBWTRDZCLCLSB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|