About 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole
1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole (PubChem CID 62892546) has the molecular formula C13H8Cl2N4O2
and a molecular weight of 323.14 g/mol. Its IUPAC name is 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole.
Molecular Properties
| Compound Name | 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole |
| PubChem CID | 62892546 |
| Molecular Formula | C13H8Cl2N4O2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole |
| SMILES | O=[N+]([O-])c1ccc2cnn(Cc3nc(Cl)ccc3Cl)c2c1 |
| InChI | InChI=1S/C13H8Cl2N4O2/c14-10-3-4-13(15)17-11(10)7-18-12-5-9(19(20)21)2-1-8(12)6-16-18/h1-6H,7H2 |
| InChIKey | SRONKBPZAFKFBS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole?
The IUPAC name of 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole (CID 62892546) is 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole.
What is the SMILES notation for 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole?
The canonical SMILES for 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole is O=[N+]([O-])c1ccc2cnn(Cc3nc(Cl)ccc3Cl)c2c1.
What is the InChIKey of 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole?
The InChIKey is SRONKBPZAFKFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N4O2/c14-10-3-4-13(15)17-11(10)7-18-12-5-9(19(20)21)2-1-8(12)6-16-18/h1-6H,7H2.
What are the key properties of 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole?
1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole has a molecular weight of 323.14 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,6-dichloro-2-pyridinyl)methyl]-6-nitroindazole is sourced from PubChem (CID 62892546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).