C15H23N3OS — CID 62893452
3-[[cyclohexyl(2-hydroxyethyl)amino]methyl]pyridine-2-carbothioamide (PubChem CID 62893452) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-[[cyclohexyl(2-hydroxyethyl)amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[[cyclohexyl(2-hydroxyethyl)amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 62893452 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[[cyclohexyl(2-hydroxyethyl)amino]methyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ncccc1CN(CCO)C1CCCCC1 |
| InChI | InChI=1S/C15H23N3OS/c16-15(20)14-12(5-4-8-17-14)11-18(9-10-19)13-6-2-1-3-7-13/h4-5,8,13,19H,1-3,6-7,9-11H2,(H2,16,20) |
| InChIKey | MVOPRGGLXIQAFP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|