About 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile
3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile (PubChem CID 62894090) has the molecular formula C15H8BrN3O2
and a molecular weight of 342.15 g/mol. Its IUPAC name is 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile |
| PubChem CID | 62894090 |
| Molecular Formula | C15H8BrN3O2 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CN1C(=O)C(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C15H8BrN3O2/c16-11-5-1-4-10-13(11)19(15(21)14(10)20)8-9-3-2-6-18-12(9)7-17/h1-6H,8H2 |
| InChIKey | LNJRMKOZGJISBN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile?
The IUPAC name of 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile (CID 62894090) is 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile?
The canonical SMILES for 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile is N#Cc1ncccc1CN1C(=O)C(=O)c2cccc(Br)c21.
What is the InChIKey of 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile?
The InChIKey is LNJRMKOZGJISBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8BrN3O2/c16-11-5-1-4-10-13(11)19(15(21)14(10)20)8-9-3-2-6-18-12(9)7-17/h1-6H,8H2.
What are the key properties of 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile?
3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile has a molecular weight of 342.15 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-bromo-2,3-dioxoindol-1-yl)methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 62894090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).