C13H22N4O — CID 62894556
3-[[3-hydroxypropyl(propan-2-yl)amino]methyl]pyridine-2-carboximidamide (PubChem CID 62894556) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-[[3-hydroxypropyl(propan-2-yl)amino]methyl]pyridine-2-carboximidamide.
| Compound Name | 3-[[3-hydroxypropyl(propan-2-yl)amino]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 62894556 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-[[3-hydroxypropyl(propan-2-yl)amino]methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1CN(CCCO)C(C)C |
| InChI | InChI=1S/C13H22N4O/c1-10(2)17(7-4-8-18)9-11-5-3-6-16-12(11)13(14)15/h3,5-6,10,18H,4,7-9H2,1-2H3,(H3,14,15) |
| InChIKey | LXPALVQSTRNSTD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|