C14H21N3 — CID 62895575
3-[(heptan-2-ylamino)methyl]pyridine-2-carbonitrile (PubChem CID 62895575) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[(heptan-2-ylamino)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(heptan-2-ylamino)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62895575 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-[(heptan-2-ylamino)methyl]pyridine-2-carbonitrile |
| SMILES | CCCCCC(C)NCc1cccnc1C#N |
| InChI | InChI=1S/C14H21N3/c1-3-4-5-7-12(2)17-11-13-8-6-9-16-14(13)10-15/h6,8-9,12,17H,3-5,7,11H2,1-2H3 |
| InChIKey | MYLKBJLBJCRBSD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|