About (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate
(2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 62895643) has the molecular formula C11H10N6O2
and a molecular weight of 258.24 g/mol. Its IUPAC name is (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 62895643 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | N#Cc1ncccc1COC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C11H10N6O2/c12-4-9-8(2-1-3-14-9)6-19-10(18)5-17-7-15-11(13)16-17/h1-3,7H,5-6H2,(H2,13,16) |
| InChIKey | FHIMQSAEIGNWKS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The IUPAC name of (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (CID 62895643) is (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is N#Cc1ncccc1COC(=O)Cn1cnc(N)n1.
What is the InChIKey of (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The InChIKey is FHIMQSAEIGNWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6O2/c12-4-9-8(2-1-3-14-9)6-19-10(18)5-17-7-15-11(13)16-17/h1-3,7H,5-6H2,(H2,13,16).
What are the key properties of (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
(2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate has a molecular weight of 258.24 g/mol, XLogP of -0.13, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-3-pyridinyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 62895643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).