C11H11F3N2O3S — CID 62896310
4-(2,4,6-trifluorophenyl)sulfonyl-1,4-diazepan-2-one (PubChem CID 62896310) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 4-(2,4,6-trifluorophenyl)sulfonyl-1,4-diazepan-2-one.
| Compound Name | 4-(2,4,6-trifluorophenyl)sulfonyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62896310 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-(2,4,6-trifluorophenyl)sulfonyl-1,4-diazepan-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2c(F)cc(F)cc2F)CCCN1 |
| InChI | InChI=1S/C11H11F3N2O3S/c12-7-4-8(13)11(9(14)5-7)20(18,19)16-3-1-2-15-10(17)6-16/h4-5H,1-3,6H2,(H,15,17) |
| InChIKey | ABHYKGIIGRZHHN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |