C8H4F3N3OS — CID 62896332
5-sulfanylidene-4-(2,3,5-trifluorophenyl)-1,2,4-triazolidin-3-one (PubChem CID 62896332) has the molecular formula C8H4F3N3OS and a molecular weight of 247.20 g/mol. Its IUPAC name is 5-sulfanylidene-4-(2,3,5-trifluorophenyl)-1,2,4-triazolidin-3-one.
| Compound Name | 5-sulfanylidene-4-(2,3,5-trifluorophenyl)-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 62896332 |
| Molecular Formula | C8H4F3N3OS |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 5-sulfanylidene-4-(2,3,5-trifluorophenyl)-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C8H4F3N3OS/c9-3-1-4(10)6(11)5(2-3)14-7(15)12-13-8(14)16/h1-2H,(H,12,15)(H,13,16) |
| InChIKey | DBPVGXQHPGNMGB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|