C13H20N4O4 — CID 62896427
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(6-oxopiperidin-3-yl)propanamide (PubChem CID 62896427) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(6-oxopiperidin-3-yl)propanamide.
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(6-oxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 62896427 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(6-oxopiperidin-3-yl)propanamide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)NC2CCC(=O)NC2)C1=O |
| InChI | InChI=1S/C13H20N4O4/c1-13(2)11(20)17(12(21)16-13)6-5-10(19)15-8-3-4-9(18)14-7-8/h8H,3-7H2,1-2H3,(H,14,18)(H,15,19)(H,16,21) |
| InChIKey | IVPKPCKCNZKKNX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|